About 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea
1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea (PubChem CID 75358110) has the molecular formula C20H23N5O2
and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
| PubChem CID | 75358110 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
| SMILES | O=C(NCc1cn2ccccc2n1)Nc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C20H23N5O2/c26-20(21-13-17-15-25-8-4-3-7-19(25)22-17)23-18-6-2-1-5-16(18)14-24-9-11-27-12-10-24/h1-8,15H,9-14H2,(H2,21,23,26) |
| InChIKey | GHNCELFSOBUFBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea?
The IUPAC name of 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea (CID 75358110) is 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea.
What is the SMILES notation for 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea?
The canonical SMILES for 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea is O=C(NCc1cn2ccccc2n1)Nc1ccccc1CN1CCOCC1.
What is the InChIKey of 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea?
The InChIKey is GHNCELFSOBUFBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O2/c26-20(21-13-17-15-25-8-4-3-7-19(25)22-17)23-18-6-2-1-5-16(18)14-24-9-11-27-12-10-24/h1-8,15H,9-14H2,(H2,21,23,26).
What are the key properties of 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea?
1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea has a molecular weight of 365.44 g/mol, XLogP of 2.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-[2-(morpholin-4-ylmethyl)phenyl]urea is sourced from PubChem (CID 75358110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).