C14H19N3O2 — CID 79032623
4-[(imidazo[1,2-a]pyridin-2-ylmethylamino)methyl]oxan-4-ol (PubChem CID 79032623) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[(imidazo[1,2-a]pyridin-2-ylmethylamino)methyl]oxan-4-ol.
| Compound Name | 4-[(imidazo[1,2-a]pyridin-2-ylmethylamino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 79032623 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[(imidazo[1,2-a]pyridin-2-ylmethylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNCc2cn3ccccc3n2)CCOCC1 |
| InChI | InChI=1S/C14H19N3O2/c18-14(4-7-19-8-5-14)11-15-9-12-10-17-6-2-1-3-13(17)16-12/h1-3,6,10,15,18H,4-5,7-9,11H2 |
| InChIKey | FBSGQJOSJQUUCF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |