C18H22ClN3O6 — CID 75360481
4-(2-chloro-5-nitrobenzoyl)-8-propyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 75360481) has the molecular formula C18H22ClN3O6 and a molecular weight of 411.84 g/mol. Its IUPAC name is 4-(2-chloro-5-nitrobenzoyl)-8-propyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | 4-(2-chloro-5-nitrobenzoyl)-8-propyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 75360481 |
| Molecular Formula | C18H22ClN3O6 |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-(2-chloro-5-nitrobenzoyl)-8-propyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CCCN1CCC2(CC1)OCC(C(=O)O)N2C(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H22ClN3O6/c1-2-7-20-8-5-18(6-9-20)21(15(11-28-18)17(24)25)16(23)13-10-12(22(26)27)3-4-14(13)19/h3-4,10,15H,2,5-9,11H2,1H3,(H,24,25) |
| InChIKey | KXWUVSYBBYECRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|