C23H23N3O7 — CID 46140518
4-(2-methylbenzoyl)-8-(3-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 46140518) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is 4-(2-methylbenzoyl)-8-(3-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | 4-(2-methylbenzoyl)-8-(3-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 46140518 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-(2-methylbenzoyl)-8-(3-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | Cc1ccccc1C(=O)N1C(C(=O)O)COC12CCN(C(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C23H23N3O7/c1-15-5-2-3-8-18(15)21(28)25-19(22(29)30)14-33-23(25)9-11-24(12-10-23)20(27)16-6-4-7-17(13-16)26(31)32/h2-8,13,19H,9-12,14H2,1H3,(H,29,30) |
| InChIKey | DQOXEWMMWCKGCL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|