C26H27N5O3S — CID 75361249
N-[2-[6-[2-(butylamino)-4-methyl-1,3-thiazole-5-carbonyl]-3-oxo-4H-quinoxalin-2-yl]phenyl]propanamide (PubChem CID 75361249) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[2-[6-[2-(butylamino)-4-methyl-1,3-thiazole-5-carbonyl]-3-oxo-4H-quinoxalin-2-yl]phenyl]propanamide.
| Compound Name | N-[2-[6-[2-(butylamino)-4-methyl-1,3-thiazole-5-carbonyl]-3-oxo-4H-quinoxalin-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 75361249 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[2-[6-[2-(butylamino)-4-methyl-1,3-thiazole-5-carbonyl]-3-oxo-4H-quinoxalin-2-yl]phenyl]propanamide |
| SMILES | CCCCNc1nc(C)c(C(=O)c2ccc3nc(-c4ccccc4NC(=O)CC)c(=O)[nH]c3c2)s1 |
| InChI | InChI=1S/C26H27N5O3S/c1-4-6-13-27-26-28-15(3)24(35-26)23(33)16-11-12-19-20(14-16)31-25(34)22(30-19)17-9-7-8-10-18(17)29-21(32)5-2/h7-12,14H,4-6,13H2,1-3H3,(H,27,28)(H,29,32)(H,31,34) |
| InChIKey | XKGLVKBIJONJOS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|