C18H16ClF3N2OS — CID 75362849
(Z)-3-(4-chlorophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]-4,4,4-trifluorobut-2-enamide (PubChem CID 75362849) has the molecular formula C18H16ClF3N2OS and a molecular weight of 400.85 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | (Z)-3-(4-chlorophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 75362849 |
| Molecular Formula | C18H16ClF3N2OS |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]-4,4,4-trifluorobut-2-enamide |
| SMILES | Cc1csc(C(NC(=O)/C=C(/c2ccc(Cl)cc2)C(F)(F)F)C2CC2)n1 |
| InChI | InChI=1S/C18H16ClF3N2OS/c1-10-9-26-17(23-10)16(12-2-3-12)24-15(25)8-14(18(20,21)22)11-4-6-13(19)7-5-11/h4-9,12,16H,2-3H2,1H3,(H,24,25)/b14-8- |
| InChIKey | LAWDHULAAOJUAG-ZSOIEALJSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|