C20H19N3O3 — CID 75365187
(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate (PubChem CID 75365187) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate.
| Compound Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75365187 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
| SMILES | Cc1cc(C)n2cc(COC(=O)/C=C/c3ccc4c(c3)CCO4)nc2n1 |
| InChI | InChI=1S/C20H19N3O3/c1-13-9-14(2)23-11-17(22-20(23)21-13)12-26-19(24)6-4-15-3-5-18-16(10-15)7-8-25-18/h3-6,9-11H,7-8,12H2,1-2H3/b6-4+ |
| InChIKey | KHTCQBKVFDMMIV-GQCTYLIASA-N |
| XLogP | 3.04 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|