C36H38N4O12 — CID 75365374
bis(1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine);oxalic acid (PubChem CID 75365374) has the molecular formula C36H38N4O12 and a molecular weight of 718.72 g/mol. Its IUPAC name is bis(1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine);oxalic acid.
| Compound Name | bis(1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine);oxalic acid |
|---|---|
| PubChem CID | 75365374 |
| Molecular Formula | C36H38N4O12 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | bis(1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(4-nitrophenyl)methyl]ethanamine);oxalic acid |
| SMILES | CC(NCc1ccc([N+](=O)[O-])cc1)C1COc2ccccc2O1.CC(NCc1ccc([N+](=O)[O-])cc1)C1COc2ccccc2O1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C17H18N2O4.C2H2O4/c2*1-12(17-11-22-15-4-2-3-5-16(15)23-17)18-10-13-6-8-14(9-7-13)19(20)21;3-1(4)2(5)6/h2*2-9,12,17-18H,10-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | UFFQYJIQBYALDB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 221.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|