C16H22N2O4 — CID 139013856
cis-(1S,3R)-2,2-dimethyl-3-[1-[(4-nitrophenyl)methylamino]ethyl]cyclobutane-1-carboxylic acid (PubChem CID 139013856) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dimethyl-3-[1-[(4-nitrophenyl)methylamino]ethyl]cyclobutane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-2,2-dimethyl-3-[1-[(4-nitrophenyl)methylamino]ethyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 139013856 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | cis-(1S,3R)-2,2-dimethyl-3-[1-[(4-nitrophenyl)methylamino]ethyl]cyclobutane-1-carboxylic acid |
| SMILES | CC(NCc1ccc([N+](=O)[O-])cc1)[C@@H]1C[C@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C16H22N2O4/c1-10(13-8-14(15(19)20)16(13,2)3)17-9-11-4-6-12(7-5-11)18(21)22/h4-7,10,13-14,17H,8-9H2,1-3H3,(H,19,20)/t10?,13-,14+/m0/s1 |
| InChIKey | ASHSSNFSRZCPKS-INPHSSGZSA-N |
| XLogP | 2.82 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|