C16H21N3O2 — CID 75367720
(6R)-4-[(1-methylpyrazol-4-yl)methyl]-6-phenoxy-1,4-oxazepane (PubChem CID 75367720) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (6R)-4-[(1-methylpyrazol-4-yl)methyl]-6-phenoxy-1,4-oxazepane.
| Compound Name | (6R)-4-[(1-methylpyrazol-4-yl)methyl]-6-phenoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 75367720 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (6R)-4-[(1-methylpyrazol-4-yl)methyl]-6-phenoxy-1,4-oxazepane |
| SMILES | Cn1cc(CN2CCOC[C@H](Oc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C16H21N3O2/c1-18-10-14(9-17-18)11-19-7-8-20-13-16(12-19)21-15-5-3-2-4-6-15/h2-6,9-10,16H,7-8,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | WLJGBFXIDXXCCJ-MRXNPFEDSA-N |
| XLogP | 1.70 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |