About 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate
2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate (PubChem CID 75370370) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate.
Molecular Properties
| Compound Name | 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate |
| PubChem CID | 75370370 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate |
| SMILES | CCOc1cccc(C(=O)OCCn2ncc(C#N)c2N)c1 |
| InChI | InChI=1S/C15H16N4O3/c1-2-21-13-5-3-4-11(8-13)15(20)22-7-6-19-14(17)12(9-16)10-18-19/h3-5,8,10H,2,6-7,17H2,1H3 |
| InChIKey | RZNWQBMRECCWFT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate?
The IUPAC name of 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate (CID 75370370) is 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate.
What is the SMILES notation for 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate?
The canonical SMILES for 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate is CCOc1cccc(C(=O)OCCn2ncc(C#N)c2N)c1.
What is the InChIKey of 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate?
The InChIKey is RZNWQBMRECCWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-2-21-13-5-3-4-11(8-13)15(20)22-7-6-19-14(17)12(9-16)10-18-19/h3-5,8,10H,2,6-7,17H2,1H3.
What are the key properties of 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate?
2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate has a molecular weight of 300.32 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-4-cyanopyrazol-1-yl)ethyl 3-ethoxybenzoate is sourced from PubChem (CID 75370370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).