C18H19FN4O — CID 75374104
N-[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 75374104) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75374104 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC1CCN(c2ccc(F)cc2C#N)CC1 |
| InChI | InChI=1S/C18H19FN4O/c1-22-8-2-3-17(22)18(24)21-15-6-9-23(10-7-15)16-5-4-14(19)11-13(16)12-20/h2-5,8,11,15H,6-7,9-10H2,1H3,(H,21,24) |
| InChIKey | CJMJZFSBRAQHDX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |