C18H25FN6O3 — CID 143154102
(2R,3S)-N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]-4-hydrazinyl-2,3-dihydroxy-4-methyliminobutanamide (PubChem CID 143154102) has the molecular formula C18H25FN6O3 and a molecular weight of 392.44 g/mol. Its IUPAC name is (2R,3S)-N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]-4-hydrazinyl-2,3-dihydroxy-4-methyliminobutanamide.
| Compound Name | (2R,3S)-N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]-4-hydrazinyl-2,3-dihydroxy-4-methyliminobutanamide |
|---|---|
| PubChem CID | 143154102 |
| Molecular Formula | C18H25FN6O3 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2R,3S)-N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]-4-hydrazinyl-2,3-dihydroxy-4-methyliminobutanamide |
| SMILES | C/N=C(\NN)[C@H](O)[C@@H](O)C(=O)NCC1CCN(c2ccc(F)cc2C#N)CC1 |
| InChI | InChI=1S/C18H25FN6O3/c1-22-17(24-21)15(26)16(27)18(28)23-10-11-4-6-25(7-5-11)14-3-2-13(19)8-12(14)9-20/h2-3,8,11,15-16,26-27H,4-7,10,21H2,1H3,(H,22,24)(H,23,28)/t15-,16-/m1/s1 |
| InChIKey | MTXBVICLMNDLIN-HZPDHXFCSA-N |
| XLogP | -0.76 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|