C26H32FN5O4 — CID 143478678
N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]formamide;(2R,3S)-1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)-2,3-dihydroxybutan-1-one (PubChem CID 143478678) has the molecular formula C26H32FN5O4 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]formamide;(2R,3S)-1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)-2,3-dihydroxybutan-1-one.
| Compound Name | N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]formamide;(2R,3S)-1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)-2,3-dihydroxybutan-1-one |
|---|---|
| PubChem CID | 143478678 |
| Molecular Formula | C26H32FN5O4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[[1-(2-cyano-4-fluorophenyl)piperidin-4-yl]methyl]formamide;(2R,3S)-1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)-2,3-dihydroxybutan-1-one |
| SMILES | C[C@H](O)[C@@H](O)C(=O)N1CCc2cccnc2C1.N#Cc1cc(F)ccc1N1CCC(CNC=O)CC1 |
| InChI | InChI=1S/C14H16FN3O.C12H16N2O3/c15-13-1-2-14(12(7-13)8-16)18-5-3-11(4-6-18)9-17-10-19;1-8(15)11(16)12(17)14-6-4-9-3-2-5-13-10(9)7-14/h1-2,7,10-11H,3-6,9H2,(H,17,19);2-3,5,8,11,15-16H,4,6-7H2,1H3/t;8-,11+/m.0/s1 |
| InChIKey | HJCKBUZBWOXCIQ-ROOOVUHGSA-N |
| XLogP | 1.37 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|