C18H19F2NO3 — CID 75374492
N-[2-[(2,5-difluorophenyl)methyl]-3-hydroxypropyl]-4-methoxybenzamide (PubChem CID 75374492) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is N-[2-[(2,5-difluorophenyl)methyl]-3-hydroxypropyl]-4-methoxybenzamide.
| Compound Name | N-[2-[(2,5-difluorophenyl)methyl]-3-hydroxypropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 75374492 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[2-[(2,5-difluorophenyl)methyl]-3-hydroxypropyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(CO)Cc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C18H19F2NO3/c1-24-16-5-2-13(3-6-16)18(23)21-10-12(11-22)8-14-9-15(19)4-7-17(14)20/h2-7,9,12,22H,8,10-11H2,1H3,(H,21,23) |
| InChIKey | PQWHIDDIAWEIOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |