C15H18FN3O3S — CID 75376134
5-(ethylsulfamoyl)-2-fluoro-N-methyl-N-(1H-pyrrol-2-ylmethyl)benzamide (PubChem CID 75376134) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-2-fluoro-N-methyl-N-(1H-pyrrol-2-ylmethyl)benzamide.
| Compound Name | 5-(ethylsulfamoyl)-2-fluoro-N-methyl-N-(1H-pyrrol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 75376134 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-(ethylsulfamoyl)-2-fluoro-N-methyl-N-(1H-pyrrol-2-ylmethyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)N(C)Cc2ccc[nH]2)c1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-3-18-23(21,22)12-6-7-14(16)13(9-12)15(20)19(2)10-11-5-4-8-17-11/h4-9,17-18H,3,10H2,1-2H3 |
| InChIKey | FVFJSORPNIJONO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |