About 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol
2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol (PubChem CID 7537657) has the molecular formula C7H8O3S
and a molecular weight of 172.20 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol.
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol (CID 7537657) is 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol is OCc1scc2c1OCCO2.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol?
The InChIKey is LRWVQOFWMRDMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h4,8H,1-3H2.
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol?
2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol has a molecular weight of 172.20 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol is sourced from PubChem (CID 7537657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).