C20H16F2N2O4 — CID 7537734
[2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 7537734) has the molecular formula C20H16F2N2O4 and a molecular weight of 386.35 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7537734 |
| Molecular Formula | C20H16F2N2O4 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)OCC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H16F2N2O4/c1-2-27-15-8-6-13(7-9-15)10-14(11-23)20(26)28-12-18(25)24-19-16(21)4-3-5-17(19)22/h3-10H,2,12H2,1H3,(H,24,25)/b14-10+ |
| InChIKey | CESSIASKAZFUCO-GXDHUFHOSA-N |
| XLogP | 3.45 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|