C16H10F2N2O4 — CID 7560226
[2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 7560226) has the molecular formula C16H10F2N2O4 and a molecular weight of 332.26 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7560226 |
| Molecular Formula | C16H10F2N2O4 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | N#C/C(=C\c1ccco1)C(=O)OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H10F2N2O4/c17-12-4-1-5-13(18)15(12)20-14(21)9-24-16(22)10(8-19)7-11-3-2-6-23-11/h1-7H,9H2,(H,20,21)/b10-7+ |
| InChIKey | IVOCIGRYQPYLGZ-JXMROGBWSA-N |
| XLogP | 2.65 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|