C17H13BrN2O4 — CID 7914692
[2-(2-bromo-4-methylanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 7914692) has the molecular formula C17H13BrN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7914692 |
| Molecular Formula | C17H13BrN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)/C(C#N)=C/c2ccco2)c(Br)c1 |
| InChI | InChI=1S/C17H13BrN2O4/c1-11-4-5-15(14(18)7-11)20-16(21)10-24-17(22)12(9-19)8-13-3-2-6-23-13/h2-8H,10H2,1H3,(H,20,21)/b12-8+ |
| InChIKey | JMGHPMNSWAOXLR-XYOKQWHBSA-N |
| XLogP | 3.44 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|