C18H16N2O6 — CID 7914483
[2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 7914483) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7914483 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | COc1ccc(NC(=O)COC(=O)/C(C#N)=C/c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O6/c1-23-13-5-6-15(16(9-13)24-2)20-17(21)11-26-18(22)12(10-19)8-14-4-3-7-25-14/h3-9H,11H2,1-2H3,(H,20,21)/b12-8+ |
| InChIKey | LNDDMKVIGXVXIR-XYOKQWHBSA-N |
| XLogP | 2.39 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|