C18H12F3N3O5 — CID 7914705
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 7914705) has the molecular formula C18H12F3N3O5 and a molecular weight of 407.30 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7914705 |
| Molecular Formula | C18H12F3N3O5 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | N#C/C(=C\c1ccco1)C(=O)OCC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H12F3N3O5/c19-12-3-4-13(17(21)16(12)20)24-14(25)8-23-15(26)9-29-18(27)10(7-22)6-11-2-1-5-28-11/h1-6H,8-9H2,(H,23,26)(H,24,25)/b10-6+ |
| InChIKey | ZTNGGEZDVFZDHG-UXBLZVDNSA-N |
| XLogP | 1.90 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|