C16H14N2O6S — CID 94191079
(Z)-2-cyano-N-(2,4-dimethoxyphenyl)sulfonyl-3-(furan-2-yl)prop-2-enamide (PubChem CID 94191079) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dimethoxyphenyl)sulfonyl-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dimethoxyphenyl)sulfonyl-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 94191079 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dimethoxyphenyl)sulfonyl-3-(furan-2-yl)prop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)/C(C#N)=C\c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C16H14N2O6S/c1-22-12-5-6-15(14(9-12)23-2)25(20,21)18-16(19)11(10-17)8-13-4-3-7-24-13/h3-9H,1-2H3,(H,18,19)/b11-8- |
| InChIKey | IWIDQNUGYCYDCS-FLIBITNWSA-N |
| XLogP | 1.71 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|