C20H19N3OS — CID 75378493
N-cyclopropyl-N-(1-pyridin-3-ylethyl)-4-(1,3-thiazol-4-yl)benzamide (PubChem CID 75378493) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is N-cyclopropyl-N-(1-pyridin-3-ylethyl)-4-(1,3-thiazol-4-yl)benzamide.
| Compound Name | N-cyclopropyl-N-(1-pyridin-3-ylethyl)-4-(1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 75378493 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-cyclopropyl-N-(1-pyridin-3-ylethyl)-4-(1,3-thiazol-4-yl)benzamide |
| SMILES | CC(c1cccnc1)N(C(=O)c1ccc(-c2cscn2)cc1)C1CC1 |
| InChI | InChI=1S/C20H19N3OS/c1-14(17-3-2-10-21-11-17)23(18-8-9-18)20(24)16-6-4-15(5-7-16)19-12-25-13-22-19/h2-7,10-14,18H,8-9H2,1H3 |
| InChIKey | QSDWEJYXORNGOP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |