C16H28N4O2S — CID 75379307
N-[2-[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 75379307) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[2-[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 75379307 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[2-[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CC(C)(C)c1nccc(N2CCCCC2CCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C16H28N4O2S/c1-16(2,3)15-17-10-9-14(19-15)20-12-6-5-7-13(20)8-11-18-23(4,21)22/h9-10,13,18H,5-8,11-12H2,1-4H3 |
| InChIKey | ZCEQIXCHTZOQMR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |