C15H20F2N2OS — CID 75379365
3-(2,6-difluorophenyl)-1-(3-ethylsulfanylcyclopentyl)-1-methylurea (PubChem CID 75379365) has the molecular formula C15H20F2N2OS and a molecular weight of 314.40 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1-(3-ethylsulfanylcyclopentyl)-1-methylurea.
| Compound Name | 3-(2,6-difluorophenyl)-1-(3-ethylsulfanylcyclopentyl)-1-methylurea |
|---|---|
| PubChem CID | 75379365 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1-(3-ethylsulfanylcyclopentyl)-1-methylurea |
| SMILES | CCSC1CCC(N(C)C(=O)Nc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H20F2N2OS/c1-3-21-11-8-7-10(9-11)19(2)15(20)18-14-12(16)5-4-6-13(14)17/h4-6,10-11H,3,7-9H2,1-2H3,(H,18,20) |
| InChIKey | VQUIEMMQQPWDRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |