C15H19IN2O3S — CID 99783416
N-[(1S,3R)-3-ethylsulfanylcyclopentyl]-2-iodo-N-methyl-3-nitrobenzamide (PubChem CID 99783416) has the molecular formula C15H19IN2O3S and a molecular weight of 434.30 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethylsulfanylcyclopentyl]-2-iodo-N-methyl-3-nitrobenzamide.
| Compound Name | N-[(1S,3R)-3-ethylsulfanylcyclopentyl]-2-iodo-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 99783416 |
| Molecular Formula | C15H19IN2O3S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-[(1S,3R)-3-ethylsulfanylcyclopentyl]-2-iodo-N-methyl-3-nitrobenzamide |
| SMILES | CCS[C@@H]1CC[C@H](N(C)C(=O)c2cccc([N+](=O)[O-])c2I)C1 |
| InChI | InChI=1S/C15H19IN2O3S/c1-3-22-11-8-7-10(9-11)17(2)15(19)12-5-4-6-13(14(12)16)18(20)21/h4-6,10-11H,3,7-9H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | XWBQMZJJOXQENO-WDEREUQCSA-N |
| XLogP | 3.95 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|