C13H17Cl2NO2S — CID 75380064
4-[(3,4-dichlorophenyl)methylsulfinyl]-N,N-dimethylbutanamide (PubChem CID 75380064) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfinyl]-N,N-dimethylbutanamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 75380064 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCS(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-16(2)13(17)4-3-7-19(18)9-10-5-6-11(14)12(15)8-10/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | AFYZAOZONJZRKY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |