C13H17Cl2NO3S — CID 97328856
N-[3-[(1S)-1-(3,4-dichlorophenyl)ethyl]sulfonylpropyl]acetamide (PubChem CID 97328856) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is N-[3-[(1S)-1-(3,4-dichlorophenyl)ethyl]sulfonylpropyl]acetamide.
| Compound Name | N-[3-[(1S)-1-(3,4-dichlorophenyl)ethyl]sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 97328856 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[3-[(1S)-1-(3,4-dichlorophenyl)ethyl]sulfonylpropyl]acetamide |
| SMILES | CC(=O)NCCCS(=O)(=O)[C@@H](C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-9(11-4-5-12(14)13(15)8-11)20(18,19)7-3-6-16-10(2)17/h4-5,8-9H,3,6-7H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | KCBLGOXHHUKCHA-VIFPVBQESA-N |
| XLogP | 3.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|