About 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide
5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide (PubChem CID 75380557) has the molecular formula C13H13F2N3O2
and a molecular weight of 281.26 g/mol. Its IUPAC name is 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide |
| PubChem CID | 75380557 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide |
| SMILES | CCc1cnc(CNc2cc(C(N)=O)c(F)cc2F)o1 |
| InChI | InChI=1S/C13H13F2N3O2/c1-2-7-5-18-12(20-7)6-17-11-3-8(13(16)19)9(14)4-10(11)15/h3-5,17H,2,6H2,1H3,(H2,16,19) |
| InChIKey | UDVUQHVZBUONQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide?
The IUPAC name of 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide (CID 75380557) is 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide.
What is the SMILES notation for 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide?
The canonical SMILES for 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide is CCc1cnc(CNc2cc(C(N)=O)c(F)cc2F)o1.
What is the InChIKey of 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide?
The InChIKey is UDVUQHVZBUONQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O2/c1-2-7-5-18-12(20-7)6-17-11-3-8(13(16)19)9(14)4-10(11)15/h3-5,17H,2,6H2,1H3,(H2,16,19).
What are the key properties of 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide?
5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide has a molecular weight of 281.26 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2,4-difluorobenzamide is sourced from PubChem (CID 75380557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).