C17H20N2O2S — CID 75384152
[1-(thiophen-3-ylmethyl)piperidin-4-yl] 5-methylpyridine-3-carboxylate (PubChem CID 75384152) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is [1-(thiophen-3-ylmethyl)piperidin-4-yl] 5-methylpyridine-3-carboxylate.
| Compound Name | [1-(thiophen-3-ylmethyl)piperidin-4-yl] 5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 75384152 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [1-(thiophen-3-ylmethyl)piperidin-4-yl] 5-methylpyridine-3-carboxylate |
| SMILES | Cc1cncc(C(=O)OC2CCN(Cc3ccsc3)CC2)c1 |
| InChI | InChI=1S/C17H20N2O2S/c1-13-8-15(10-18-9-13)17(20)21-16-2-5-19(6-3-16)11-14-4-7-22-12-14/h4,7-10,12,16H,2-3,5-6,11H2,1H3 |
| InChIKey | OZBFUIKNZPJGGQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |