C21H27NO3S — CID 154704719
(4-methylphenyl)methyl 3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxypropanoate (PubChem CID 154704719) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxypropanoate.
| Compound Name | (4-methylphenyl)methyl 3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxypropanoate |
|---|---|
| PubChem CID | 154704719 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (4-methylphenyl)methyl 3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxypropanoate |
| SMILES | Cc1ccc(COC(=O)CCOC2CCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-17-2-4-18(5-3-17)15-25-21(23)8-12-24-20-6-10-22(11-7-20)14-19-9-13-26-16-19/h2-5,9,13,16,20H,6-8,10-12,14-15H2,1H3 |
| InChIKey | GSKKKJKZTSXLEV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |