C17H13F2N3O — CID 75387472
1-(2,4-difluorophenyl)-5-methyl-N,N-bis(prop-2-ynyl)pyrazole-3-carboxamide (PubChem CID 75387472) has the molecular formula C17H13F2N3O and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-methyl-N,N-bis(prop-2-ynyl)pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-5-methyl-N,N-bis(prop-2-ynyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 75387472 |
| Molecular Formula | C17H13F2N3O |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-methyl-N,N-bis(prop-2-ynyl)pyrazole-3-carboxamide |
| SMILES | C#CCN(CC#C)C(=O)c1cc(C)n(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C17H13F2N3O/c1-4-8-21(9-5-2)17(23)15-10-12(3)22(20-15)16-7-6-13(18)11-14(16)19/h1-2,6-7,10-11H,8-9H2,3H3 |
| InChIKey | CHCGDEHBIUJUSK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|