C19H22N4O2 — CID 75389970
3-[(3-methoxyphenyl)methoxy]-2-methyl-N-[(3-methyltriazol-4-yl)methyl]aniline (PubChem CID 75389970) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methoxy]-2-methyl-N-[(3-methyltriazol-4-yl)methyl]aniline.
| Compound Name | 3-[(3-methoxyphenyl)methoxy]-2-methyl-N-[(3-methyltriazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 75389970 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[(3-methoxyphenyl)methoxy]-2-methyl-N-[(3-methyltriazol-4-yl)methyl]aniline |
| SMILES | COc1cccc(COc2cccc(NCc3cnnn3C)c2C)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-18(20-11-16-12-21-22-23(16)2)8-5-9-19(14)25-13-15-6-4-7-17(10-15)24-3/h4-10,12,20H,11,13H2,1-3H3 |
| InChIKey | SCQIXZNKCGWMJY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |