C15H11N3O3 — CID 75390658
5-(1-benzofuran-3-carbonylamino)pyridine-2-carboxamide (PubChem CID 75390658) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 5-(1-benzofuran-3-carbonylamino)pyridine-2-carboxamide.
| Compound Name | 5-(1-benzofuran-3-carbonylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 75390658 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-(1-benzofuran-3-carbonylamino)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2coc3ccccc23)cn1 |
| InChI | InChI=1S/C15H11N3O3/c16-14(19)12-6-5-9(7-17-12)18-15(20)11-8-21-13-4-2-1-3-10(11)13/h1-8H,(H2,16,19)(H,18,20) |
| InChIKey | FVIFFINRQUAXRH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |