C23H13NO4 — CID 2892917
N-(9,10-dioxoanthracen-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 2892917) has the molecular formula C23H13NO4 and a molecular weight of 367.36 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 2892917 |
| Molecular Formula | C23H13NO4 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)c2cc(NC(=O)c3coc4ccccc34)ccc21 |
| InChI | InChI=1S/C23H13NO4/c25-21-15-6-1-2-7-16(15)22(26)18-11-13(9-10-17(18)21)24-23(27)19-12-28-20-8-4-3-5-14(19)20/h1-12H,(H,24,27) |
| InChIKey | GEUNTHYDKDNFDT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|