C20H29N3O3S — CID 75390876
8-[[2-(3-methylbutoxy)cyclohexyl]amino]quinoline-5-sulfonamide (PubChem CID 75390876) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 8-[[2-(3-methylbutoxy)cyclohexyl]amino]quinoline-5-sulfonamide.
| Compound Name | 8-[[2-(3-methylbutoxy)cyclohexyl]amino]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 75390876 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 8-[[2-(3-methylbutoxy)cyclohexyl]amino]quinoline-5-sulfonamide |
| SMILES | CC(C)CCOC1CCCCC1Nc1ccc(S(N)(=O)=O)c2cccnc12 |
| InChI | InChI=1S/C20H29N3O3S/c1-14(2)11-13-26-18-8-4-3-7-16(18)23-17-9-10-19(27(21,24)25)15-6-5-12-22-20(15)17/h5-6,9-10,12,14,16,18,23H,3-4,7-8,11,13H2,1-2H3,(H2,21,24,25) |
| InChIKey | LATJXGXGPISQIP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |