C18H19NO7 — CID 75391719
1-O-ethyl 1-O'-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] cyclobutane-1,1-dicarboxylate (PubChem CID 75391719) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-O-ethyl 1-O'-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] cyclobutane-1,1-dicarboxylate.
| Compound Name | 1-O-ethyl 1-O'-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 75391719 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-O-ethyl 1-O'-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] cyclobutane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC(=O)c2ccc3c(c2)NC(=O)CO3)CCC1 |
| InChI | InChI=1S/C18H19NO7/c1-2-24-16(22)18(6-3-7-18)17(23)26-9-13(20)11-4-5-14-12(8-11)19-15(21)10-25-14/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,19,21) |
| InChIKey | HMYPEMHZEQQRGI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|