C23H37N3O3 — CID 75392754
4-[cyclohexyl(methyl)amino]-N-[1-(2-hydroxy-3-methoxypropyl)piperidin-4-yl]benzamide (PubChem CID 75392754) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)amino]-N-[1-(2-hydroxy-3-methoxypropyl)piperidin-4-yl]benzamide.
| Compound Name | 4-[cyclohexyl(methyl)amino]-N-[1-(2-hydroxy-3-methoxypropyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 75392754 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 4-[cyclohexyl(methyl)amino]-N-[1-(2-hydroxy-3-methoxypropyl)piperidin-4-yl]benzamide |
| SMILES | COCC(O)CN1CCC(NC(=O)c2ccc(N(C)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H37N3O3/c1-25(20-6-4-3-5-7-20)21-10-8-18(9-11-21)23(28)24-19-12-14-26(15-13-19)16-22(27)17-29-2/h8-11,19-20,22,27H,3-7,12-17H2,1-2H3,(H,24,28) |
| InChIKey | JGBRFKUILIKJLX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |