C18H20ClN3O3 — CID 75394653
methyl 3-(4-chlorophenyl)-3-[[(E)-3-(1-ethylimidazol-2-yl)prop-2-enoyl]amino]propanoate (PubChem CID 75394653) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[[(E)-3-(1-ethylimidazol-2-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[[(E)-3-(1-ethylimidazol-2-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 75394653 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[[(E)-3-(1-ethylimidazol-2-yl)prop-2-enoyl]amino]propanoate |
| SMILES | CCn1ccnc1/C=C/C(=O)NC(CC(=O)OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-3-22-11-10-20-16(22)8-9-17(23)21-15(12-18(24)25-2)13-4-6-14(19)7-5-13/h4-11,15H,3,12H2,1-2H3,(H,21,23)/b9-8+ |
| InChIKey | DLGYFVBQMBOMHN-CMDGGOBGSA-N |
| XLogP | 2.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|