C19H21FN2O4S — CID 75394970
3-[[4-(4-fluorophenyl)-4-oxobutan-2-yl]sulfamoyl]-N,N-dimethylbenzamide (PubChem CID 75394970) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)-4-oxobutan-2-yl]sulfamoyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-(4-fluorophenyl)-4-oxobutan-2-yl]sulfamoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 75394970 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)-4-oxobutan-2-yl]sulfamoyl]-N,N-dimethylbenzamide |
| SMILES | CC(CC(=O)c1ccc(F)cc1)NS(=O)(=O)c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-13(11-18(23)14-7-9-16(20)10-8-14)21-27(25,26)17-6-4-5-15(12-17)19(24)22(2)3/h4-10,12-13,21H,11H2,1-3H3 |
| InChIKey | VUJKVSGSISYCRL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |