C22H21N3O2 — CID 75396943
5-(3-cyanophenoxy)-N-(6-methylquinolin-8-yl)pentanamide (PubChem CID 75396943) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-(3-cyanophenoxy)-N-(6-methylquinolin-8-yl)pentanamide.
| Compound Name | 5-(3-cyanophenoxy)-N-(6-methylquinolin-8-yl)pentanamide |
|---|---|
| PubChem CID | 75396943 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-(3-cyanophenoxy)-N-(6-methylquinolin-8-yl)pentanamide |
| SMILES | Cc1cc(NC(=O)CCCCOc2cccc(C#N)c2)c2ncccc2c1 |
| InChI | InChI=1S/C22H21N3O2/c1-16-12-18-7-5-10-24-22(18)20(13-16)25-21(26)9-2-3-11-27-19-8-4-6-17(14-19)15-23/h4-8,10,12-14H,2-3,9,11H2,1H3,(H,25,26) |
| InChIKey | UQQMRSZAXMZDKE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|