C22H33N3O — CID 163526669
7-(diethylamino)-4-methyl-N-(6-methylquinolin-8-yl)heptanamide (PubChem CID 163526669) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 7-(diethylamino)-4-methyl-N-(6-methylquinolin-8-yl)heptanamide.
| Compound Name | 7-(diethylamino)-4-methyl-N-(6-methylquinolin-8-yl)heptanamide |
|---|---|
| PubChem CID | 163526669 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 7-(diethylamino)-4-methyl-N-(6-methylquinolin-8-yl)heptanamide |
| SMILES | CCN(CC)CCCC(C)CCC(=O)Nc1cc(C)cc2cccnc12 |
| InChI | InChI=1S/C22H33N3O/c1-5-25(6-2)14-8-9-17(3)11-12-21(26)24-20-16-18(4)15-19-10-7-13-23-22(19)20/h7,10,13,15-17H,5-6,8-9,11-12,14H2,1-4H3,(H,24,26) |
| InChIKey | HLCCEGWBWICBCD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |