C17H25NO5S — CID 75397053
methyl 3-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]-4-propan-2-yloxybenzoate (PubChem CID 75397053) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is methyl 3-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]-4-propan-2-yloxybenzoate.
| Compound Name | methyl 3-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 75397053 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 3-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]-4-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1ccc(OC(C)C)c(NCC2(CS(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C17H25NO5S/c1-12(2)23-15-6-5-13(16(19)22-3)9-14(15)18-10-17(7-8-17)11-24(4,20)21/h5-6,9,12,18H,7-8,10-11H2,1-4H3 |
| InChIKey | HDOUMMMDAIENTH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |