C12H11N5O2S — CID 75398510
3-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]thiophen-2-amine (PubChem CID 75398510) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is 3-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]thiophen-2-amine.
| Compound Name | 3-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]thiophen-2-amine |
|---|---|
| PubChem CID | 75398510 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]thiophen-2-amine |
| SMILES | O=[N+]([O-])c1ccsc1NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C12H11N5O2S/c18-17(19)9-5-8-20-12(9)13-6-4-11-15-14-10-3-1-2-7-16(10)11/h1-3,5,7-8,13H,4,6H2 |
| InChIKey | BUORONNXFYRVGS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|