C12H12N2O3S — CID 75399571
(1-methylimidazol-2-yl)methyl 4-acetylthiophene-2-carboxylate (PubChem CID 75399571) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)methyl 4-acetylthiophene-2-carboxylate.
| Compound Name | (1-methylimidazol-2-yl)methyl 4-acetylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 75399571 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (1-methylimidazol-2-yl)methyl 4-acetylthiophene-2-carboxylate |
| SMILES | CC(=O)c1csc(C(=O)OCc2nccn2C)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-8(15)9-5-10(18-7-9)12(16)17-6-11-13-3-4-14(11)2/h3-5,7H,6H2,1-2H3 |
| InChIKey | DFZCIBMJIYBJDV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |