C9H9BrF4N2O2 — CID 160821391
(1-methylimidazol-2-yl)methyl 4-bromo-3,3,4,4-tetrafluorobutanoate (PubChem CID 160821391) has the molecular formula C9H9BrF4N2O2 and a molecular weight of 333.08 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)methyl 4-bromo-3,3,4,4-tetrafluorobutanoate.
| Compound Name | (1-methylimidazol-2-yl)methyl 4-bromo-3,3,4,4-tetrafluorobutanoate |
|---|---|
| PubChem CID | 160821391 |
| Molecular Formula | C9H9BrF4N2O2 |
| Molecular Weight | 333.08 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | (1-methylimidazol-2-yl)methyl 4-bromo-3,3,4,4-tetrafluorobutanoate |
| SMILES | Cn1ccnc1COC(=O)CC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C9H9BrF4N2O2/c1-16-3-2-15-6(16)5-18-7(17)4-8(11,12)9(10,13)14/h2-3H,4-5H2,1H3 |
| InChIKey | CSDHPWNWUWIKGH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.08 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|