C19H19ClN4O4S — CID 75400510
2-[1-(4-chloro-2-nitrophenyl)sulfonylpiperidin-3-yl]-6-methyl-1H-benzimidazole (PubChem CID 75400510) has the molecular formula C19H19ClN4O4S and a molecular weight of 434.91 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-nitrophenyl)sulfonylpiperidin-3-yl]-6-methyl-1H-benzimidazole.
| Compound Name | 2-[1-(4-chloro-2-nitrophenyl)sulfonylpiperidin-3-yl]-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 75400510 |
| Molecular Formula | C19H19ClN4O4S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[1-(4-chloro-2-nitrophenyl)sulfonylpiperidin-3-yl]-6-methyl-1H-benzimidazole |
| SMILES | Cc1ccc2nc(C3CCCN(S(=O)(=O)c4ccc(Cl)cc4[N+](=O)[O-])C3)[nH]c2c1 |
| InChI | InChI=1S/C19H19ClN4O4S/c1-12-4-6-15-16(9-12)22-19(21-15)13-3-2-8-23(11-13)29(27,28)18-7-5-14(20)10-17(18)24(25)26/h4-7,9-10,13H,2-3,8,11H2,1H3,(H,21,22) |
| InChIKey | RVZSIVIDFLBYIW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|