C19H22N4O3S — CID 99837702
2-[(3R)-1-[(6-methoxy-3-pyridinyl)sulfonyl]piperidin-3-yl]-6-methyl-1H-benzimidazole (PubChem CID 99837702) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[(3R)-1-[(6-methoxy-3-pyridinyl)sulfonyl]piperidin-3-yl]-6-methyl-1H-benzimidazole.
| Compound Name | 2-[(3R)-1-[(6-methoxy-3-pyridinyl)sulfonyl]piperidin-3-yl]-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 99837702 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[(3R)-1-[(6-methoxy-3-pyridinyl)sulfonyl]piperidin-3-yl]-6-methyl-1H-benzimidazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H](c3nc4ccc(C)cc4[nH]3)C2)cn1 |
| InChI | InChI=1S/C19H22N4O3S/c1-13-5-7-16-17(10-13)22-19(21-16)14-4-3-9-23(12-14)27(24,25)15-6-8-18(26-2)20-11-15/h5-8,10-11,14H,3-4,9,12H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | OOPJMXMPDUTZQQ-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |