C18H22N4O2 — CID 75400539
N-[[3-(2-methoxyethoxy)phenyl]methyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (PubChem CID 75400539) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[[3-(2-methoxyethoxy)phenyl]methyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine.
| Compound Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 75400539 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| SMILES | COCCOc1cccc(CNc2cnc3c(c2)c(C)nn3C)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-13-17-10-15(12-20-18(17)22(2)21-13)19-11-14-5-4-6-16(9-14)24-8-7-23-3/h4-6,9-10,12,19H,7-8,11H2,1-3H3 |
| InChIKey | OPHCCNUNFIQUMX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|